C18H20O4S — CID 3053243
(3R,4S)-3,4-bis(phenylmethoxy)thiolane 1,1-dioxide (PubChem CID 3053243) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is (3R,4S)-3,4-bis(phenylmethoxy)thiolane 1,1-dioxide.
| Compound Name | (3R,4S)-3,4-bis(phenylmethoxy)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 3053243 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (3R,4S)-3,4-bis(phenylmethoxy)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)C[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C18H20O4S/c19-23(20)13-17(21-11-15-7-3-1-4-8-15)18(14-23)22-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18+ |
| InChIKey | BXCAAKYFUXHZHD-HDICACEKSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |