C23H29NO — CID 3053247
(2S,7S,11bS)-2-tert-butyl-7-phenyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ol (PubChem CID 3053247) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (2S,7S,11bS)-2-tert-butyl-7-phenyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ol.
| Compound Name | (2S,7S,11bS)-2-tert-butyl-7-phenyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 3053247 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2S,7S,11bS)-2-tert-butyl-7-phenyl-1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ol |
| SMILES | CC(C)(C)[C@]1(O)CCN2C[C@@H](c3ccccc3)c3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C23H29NO/c1-22(2,3)23(25)13-14-24-16-20(17-9-5-4-6-10-17)18-11-7-8-12-19(18)21(24)15-23/h4-12,20-21,25H,13-16H2,1-3H3/t20-,21-,23-/m0/s1 |
| InChIKey | UXKLVVLXBLXQBO-FUDKSRODSA-N |
| XLogP | 4.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |