C25H32ClNO — CID 3053248
4-tert-butyl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylmethyl)piperidin-4-ol;hydrochloride (PubChem CID 3053248) has the molecular formula C25H32ClNO and a molecular weight of 397.99 g/mol. Its IUPAC name is 4-tert-butyl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylmethyl)piperidin-4-ol;hydrochloride.
| Compound Name | 4-tert-butyl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylmethyl)piperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 3053248 |
| Molecular Formula | C25H32ClNO |
| Molecular Weight | 397.99 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 4-tert-butyl-1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylmethyl)piperidin-4-ol;hydrochloride |
| SMILES | CC(C)(C)C1(O)CCN(CC2c3ccccc3C=Cc3ccccc32)CC1.Cl |
| InChI | InChI=1S/C25H31NO.ClH/c1-24(2,3)25(27)14-16-26(17-15-25)18-23-21-10-6-4-8-19(21)12-13-20-9-5-7-11-22(20)23;/h4-13,23,27H,14-18H2,1-3H3;1H |
| InChIKey | PTESXMGDVXRVJZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|