About 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane
1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane (PubChem CID 3053269) has the molecular formula C23H39N
and a molecular weight of 329.57 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane.
Molecular Properties
| Compound Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane |
| PubChem CID | 3053269 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane |
| SMILES | CC(Cc1ccc(C(C)(C)C)cc1)CN1CCC(C)(C)CC(C)C1 |
| InChI | InChI=1S/C23H39N/c1-18(14-20-8-10-21(11-9-20)22(3,4)5)16-24-13-12-23(6,7)15-19(2)17-24/h8-11,18-19H,12-17H2,1-7H3 |
| InChIKey | AHHSZAVXRRLWGL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane?
The IUPAC name of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane (CID 3053269) is 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane.
What is the SMILES notation for 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane?
The canonical SMILES for 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane is CC(Cc1ccc(C(C)(C)C)cc1)CN1CCC(C)(C)CC(C)C1.
What is the InChIKey of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane?
The InChIKey is AHHSZAVXRRLWGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H39N/c1-18(14-20-8-10-21(11-9-20)22(3,4)5)16-24-13-12-23(6,7)15-19(2)17-24/h8-11,18-19H,12-17H2,1-7H3.
What are the key properties of 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane?
1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane has a molecular weight of 329.57 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-tert-butylphenyl)-2-methylpropyl]-3,5,5-trimethylazepane is sourced from PubChem (CID 3053269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).