C7H12ClN3O — CID 3053344
N,N,3-trimethylimidazol-3-ium-1-carboxamide chloride (PubChem CID 3053344) has the molecular formula C7H12ClN3O and a molecular weight of 189.65 g/mol. Its IUPAC name is N,N,3-trimethylimidazol-3-ium-1-carboxamide chloride.
| Compound Name | N,N,3-trimethylimidazol-3-ium-1-carboxamide chloride |
|---|---|
| PubChem CID | 3053344 |
| Molecular Formula | C7H12ClN3O |
| Molecular Weight | 189.65 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | N,N,3-trimethylimidazol-3-ium-1-carboxamide chloride |
| SMILES | CN(C)C(=O)n1cc[n+](C)c1.[Cl-] |
| InChI | InChI=1S/C7H12N3O.ClH/c1-8(2)7(11)10-5-4-9(3)6-10;/h4-6H,1-3H3;1H/q+1;/p-1 |
| InChIKey | MUIABSJHPSJBEJ-UHFFFAOYSA-M |
| XLogP | -3.15 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.65 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|