C30H36Cl2N2 — CID 3053439
1,4-diethyl-1,4-bis(naphthalen-1-ylmethyl)piperazine-1,4-diium dichloride (PubChem CID 3053439) has the molecular formula C30H36Cl2N2 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1,4-diethyl-1,4-bis(naphthalen-1-ylmethyl)piperazine-1,4-diium dichloride.
| Compound Name | 1,4-diethyl-1,4-bis(naphthalen-1-ylmethyl)piperazine-1,4-diium dichloride |
|---|---|
| PubChem CID | 3053439 |
| Molecular Formula | C30H36Cl2N2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1,4-diethyl-1,4-bis(naphthalen-1-ylmethyl)piperazine-1,4-diium dichloride |
| SMILES | CC[N+]1(Cc2cccc3ccccc23)CC[N+](CC)(Cc2cccc3ccccc23)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C30H36N2.2ClH/c1-3-31(23-27-15-9-13-25-11-5-7-17-29(25)27)19-21-32(4-2,22-20-31)24-28-16-10-14-26-12-6-8-18-30(26)28;;/h5-18H,3-4,19-24H2,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | BFSDZDZMCANBLR-UHFFFAOYSA-L |
| XLogP | 0.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|