About 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide
1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide (PubChem CID 3053444) has the molecular formula C17H30I2N2O
and a molecular weight of 532.25 g/mol. Its IUPAC name is 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide.
Molecular Properties
| Compound Name | 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide |
| PubChem CID | 3053444 |
| Molecular Formula | C17H30I2N2O |
| Molecular Weight | 532.25 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide |
| SMILES | CCCC[N+]1(C)CC[N+](Cc2ccccc2)(OC)CC1.[I-].[I-] |
| InChI | InChI=1S/C17H30N2O.2HI/c1-4-5-11-18(2)12-14-19(20-3,15-13-18)16-17-9-7-6-8-10-17;;/h6-10H,4-5,11-16H2,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | YYYVAYOTFRNJKW-UHFFFAOYSA-L |
| XLogP | -3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide?
The IUPAC name of 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide (CID 3053444) is 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide.
What is the SMILES notation for 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide?
The canonical SMILES for 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide is CCCC[N+]1(C)CC[N+](Cc2ccccc2)(OC)CC1.[I-].[I-].
What is the InChIKey of 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide?
The InChIKey is YYYVAYOTFRNJKW-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H30N2O.2HI/c1-4-5-11-18(2)12-14-19(20-3,15-13-18)16-17-9-7-6-8-10-17;;/h6-10H,4-5,11-16H2,1-3H3;2*1H/q+2;;/p-2.
What are the key properties of 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide?
1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide has a molecular weight of 532.25 g/mol, XLogP of -3.17, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-butyl-1-methoxy-4-methylpiperazine-1,4-diium diiodide is sourced from PubChem (CID 3053444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).