C12H12ClF8NO3 — CID 3053570
2-amino-1-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol;hydrochloride (PubChem CID 3053570) has the molecular formula C12H12ClF8NO3 and a molecular weight of 405.67 g/mol. Its IUPAC name is 2-amino-1-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol;hydrochloride.
| Compound Name | 2-amino-1-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 3053570 |
| Molecular Formula | C12H12ClF8NO3 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 2-amino-1-[3,5-bis(1,1,2,2-tetrafluoroethoxy)phenyl]ethanol;hydrochloride |
| SMILES | Cl.NCC(O)c1cc(OC(F)(F)C(F)F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H11F8NO3.ClH/c13-9(14)11(17,18)23-6-1-5(8(22)4-21)2-7(3-6)24-12(19,20)10(15)16;/h1-3,8-10,22H,4,21H2;1H |
| InChIKey | RAZUZFVRWIZADB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|