C21H24N2O3 — CID 3053663
9,10,18-trimethoxy-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15(20),16,18-hexaene (PubChem CID 3053663) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 9,10,18-trimethoxy-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15(20),16,18-hexaene.
| Compound Name | 9,10,18-trimethoxy-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 3053663 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 9,10,18-trimethoxy-4,14-diazapentacyclo[11.7.0.01,5.07,12.015,20]icosa-7,9,11,15(20),16,18-hexaene |
| SMILES | COc1ccc2c(c1)C13CCNC1Cc1cc(OC)c(OC)cc1C3N2 |
| InChI | InChI=1S/C21H24N2O3/c1-24-13-4-5-16-15(10-13)21-6-7-22-19(21)9-12-8-17(25-2)18(26-3)11-14(12)20(21)23-16/h4-5,8,10-11,19-20,22-23H,6-7,9H2,1-3H3 |
| InChIKey | LEOZWLCVWWYEIO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|