About 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride
2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride (PubChem CID 3053716) has the molecular formula C11H20ClN3O2
and a molecular weight of 261.75 g/mol. Its IUPAC name is 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride |
| PubChem CID | 3053716 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride |
| SMILES | CCN(CC)CC(=O)Nc1onc(C)c1C.Cl |
| InChI | InChI=1S/C11H19N3O2.ClH/c1-5-14(6-2)7-10(15)12-11-8(3)9(4)13-16-11;/h5-7H2,1-4H3,(H,12,15);1H |
| InChIKey | QQJRSIKCZRHXOQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride?
The IUPAC name of 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride (CID 3053716) is 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride?
The canonical SMILES for 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride is CCN(CC)CC(=O)Nc1onc(C)c1C.Cl.
What is the InChIKey of 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride?
The InChIKey is QQJRSIKCZRHXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2.ClH/c1-5-14(6-2)7-10(15)12-11-8(3)9(4)13-16-11;/h5-7H2,1-4H3,(H,12,15);1H.
What are the key properties of 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride?
2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride has a molecular weight of 261.75 g/mol, XLogP of 1.99, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)acetamide;hydrochloride is sourced from PubChem (CID 3053716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).