C18H24N4O2 — CID 3053794
N'-cyclohexyl-N-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate (PubChem CID 3053794) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N'-cyclohexyl-N-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate.
| Compound Name | N'-cyclohexyl-N-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate |
|---|---|
| PubChem CID | 3053794 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N'-cyclohexyl-N-[3-(1-phenylpropan-2-yl)oxadiazol-3-ium-5-yl]carbamimidate |
| SMILES | CC(Cc1ccccc1)[n+]1cc(N/C([O-])=N/C2CCCCC2)on1 |
| InChI | InChI=1S/C18H24N4O2/c1-14(12-15-8-4-2-5-9-15)22-13-17(24-21-22)20-18(23)19-16-10-6-3-7-11-16/h2,4-5,8-9,13-14,16H,3,6-7,10-12H2,1H3,(H-,19,20,21,23) |
| InChIKey | PMBXBSMJGYULPA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|