About 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride
2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride (PubChem CID 3053855) has the molecular formula C13H28Cl2N2O2
and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride |
| PubChem CID | 3053855 |
| Molecular Formula | C13H28Cl2N2O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride |
| SMILES | CCN(CC)CCOC(=O)CN1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C13H26N2O2.2ClH/c1-3-14(4-2)10-11-17-13(16)12-15-8-6-5-7-9-15;;/h3-12H2,1-2H3;2*1H |
| InChIKey | AFBNXHIDKKNMQJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride (CID 3053855) is 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride is CCN(CC)CCOC(=O)CN1CCCCC1.Cl.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride?
The InChIKey is AFBNXHIDKKNMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2.2ClH/c1-3-14(4-2)10-11-17-13(16)12-15-8-6-5-7-9-15;;/h3-12H2,1-2H3;2*1H.
What are the key properties of 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride?
2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride has a molecular weight of 315.29 g/mol, XLogP of 2.20, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-piperidin-1-ylacetate;dihydrochloride is sourced from PubChem (CID 3053855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).