About N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide
N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide (PubChem CID 3053957) has the molecular formula C11H10ClN5O
and a molecular weight of 263.69 g/mol. Its IUPAC name is N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide.
Molecular Properties
| Compound Name | N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide |
| PubChem CID | 3053957 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide |
| SMILES | CC(=O)NNc1nncc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H10ClN5O/c1-7(18)15-17-11-14-10(6-13-16-11)8-3-2-4-9(12)5-8/h2-6H,1H3,(H,15,18)(H,14,16,17) |
| InChIKey | MZBUMFFDKRQBPO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide?
The IUPAC name of N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide (CID 3053957) is N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide.
What is the SMILES notation for N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide?
The canonical SMILES for N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide is CC(=O)NNc1nncc(-c2cccc(Cl)c2)n1.
What is the InChIKey of N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide?
The InChIKey is MZBUMFFDKRQBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN5O/c1-7(18)15-17-11-14-10(6-13-16-11)8-3-2-4-9(12)5-8/h2-6H,1H3,(H,15,18)(H,14,16,17).
What are the key properties of N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide?
N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide has a molecular weight of 263.69 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]acetohydrazide is sourced from PubChem (CID 3053957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).