C12H10F3N5O — CID 3053958
2,2,2-trifluoro-N'-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]acetohydrazide (PubChem CID 3053958) has the molecular formula C12H10F3N5O and a molecular weight of 297.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N'-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 3053958 |
| Molecular Formula | C12H10F3N5O |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,2,2-trifluoro-N'-[5-(4-methylphenyl)-1,2,4-triazin-3-yl]acetohydrazide |
| SMILES | Cc1ccc(-c2cnnc(NNC(=O)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H10F3N5O/c1-7-2-4-8(5-3-7)9-6-16-19-11(17-9)20-18-10(21)12(13,14)15/h2-6H,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | GFVVSVGMLNADKY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|