About 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane
4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 3053999) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane |
| PubChem CID | 3053999 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CC12COC(c3ccccc3)(OC1)OC2 |
| InChI | InChI=1S/C12H14O3/c1-11-7-13-12(14-8-11,15-9-11)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | AABIHIQZAWJEDT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
The IUPAC name of 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane (CID 3053999) is 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane.
What is the SMILES notation for 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
The canonical SMILES for 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane is CC12COC(c3ccccc3)(OC1)OC2.
What is the InChIKey of 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
The InChIKey is AABIHIQZAWJEDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-11-7-13-12(14-8-11,15-9-11)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3.
What are the key properties of 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane?
4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane has a molecular weight of 206.24 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-phenyl-2,6,7-trioxabicyclo[2.2.2]octane is sourced from PubChem (CID 3053999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).