About 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid
4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid (PubChem CID 3054052) has the molecular formula C18H12O6
and a molecular weight of 324.29 g/mol. Its IUPAC name is 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid |
| PubChem CID | 3054052 |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)CC2(O)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H12O6/c19-14(10-5-7-11(8-6-10)17(22)23)9-18(24)15(20)12-3-1-2-4-13(12)16(18)21/h1-8,24H,9H2,(H,22,23) |
| InChIKey | MQPFXKJTQVRYIX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid?
The IUPAC name of 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid (CID 3054052) is 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid.
What is the SMILES notation for 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid?
The canonical SMILES for 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid is O=C(O)c1ccc(C(=O)CC2(O)C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid?
The InChIKey is MQPFXKJTQVRYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O6/c19-14(10-5-7-11(8-6-10)17(22)23)9-18(24)15(20)12-3-1-2-4-13(12)16(18)21/h1-8,24H,9H2,(H,22,23).
What are the key properties of 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid?
4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid has a molecular weight of 324.29 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-hydroxy-1,3-dioxoinden-2-yl)acetyl]benzoic acid is sourced from PubChem (CID 3054052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).