About 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione
2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione (PubChem CID 3054055) has the molecular formula C23H16O4
and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione.
Molecular Properties
| Compound Name | 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione |
| PubChem CID | 3054055 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)C1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H16O4/c24-20(16-11-5-2-6-12-16)19(15-9-3-1-4-10-15)23(27)21(25)17-13-7-8-14-18(17)22(23)26/h1-14,19,27H |
| InChIKey | CZSVWYPAGQHHFC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione?
The IUPAC name of 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione (CID 3054055) is 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione.
What is the SMILES notation for 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione?
The canonical SMILES for 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione is O=C(c1ccccc1)C(c1ccccc1)C1(O)C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione?
The InChIKey is CZSVWYPAGQHHFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16O4/c24-20(16-11-5-2-6-12-16)19(15-9-3-1-4-10-15)23(27)21(25)17-13-7-8-14-18(17)22(23)26/h1-14,19,27H.
What are the key properties of 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione?
2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione has a molecular weight of 356.38 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(2-oxo-1,2-diphenylethyl)indene-1,3-dione is sourced from PubChem (CID 3054055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).