About N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride
N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride (PubChem CID 3054112) has the molecular formula C13H15ClN2O2
and a molecular weight of 266.73 g/mol. Its IUPAC name is N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride |
| PubChem CID | 3054112 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride |
| SMILES | CC(Oc1cccc2ccccc12)C(N)=NO.Cl |
| InChI | InChI=1S/C13H14N2O2.ClH/c1-9(13(14)15-16)17-12-8-4-6-10-5-2-3-7-11(10)12;/h2-9,16H,1H3,(H2,14,15);1H |
| InChIKey | YLKZNGMUCBDGEM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride?
The IUPAC name of N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride (CID 3054112) is N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride.
What is the SMILES notation for N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride?
The canonical SMILES for N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride is CC(Oc1cccc2ccccc12)C(N)=NO.Cl.
What is the InChIKey of N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride?
The InChIKey is YLKZNGMUCBDGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2.ClH/c1-9(13(14)15-16)17-12-8-4-6-10-5-2-3-7-11(10)12;/h2-9,16H,1H3,(H2,14,15);1H.
What are the key properties of N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride?
N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride has a molecular weight of 266.73 g/mol, XLogP of 2.78, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-2-naphthalen-1-yloxypropanimidamide;hydrochloride is sourced from PubChem (CID 3054112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).