About 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole
1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole (PubChem CID 3054134) has the molecular formula C19H22N2S2
and a molecular weight of 342.53 g/mol. Its IUPAC name is 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole.
Molecular Properties
| Compound Name | 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole |
| PubChem CID | 3054134 |
| Molecular Formula | C19H22N2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole |
| SMILES | CCSC(Cn1ccnc1)(SCC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22N2S2/c1-3-22-19(23-4-2,14-21-12-11-20-15-21)18-10-9-16-7-5-6-8-17(16)13-18/h5-13,15H,3-4,14H2,1-2H3 |
| InChIKey | JEVCGCNIWMRUGP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole?
The IUPAC name of 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole (CID 3054134) is 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole.
What is the SMILES notation for 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole?
The canonical SMILES for 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole is CCSC(Cn1ccnc1)(SCC)c1ccc2ccccc2c1.
What is the InChIKey of 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole?
The InChIKey is JEVCGCNIWMRUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2S2/c1-3-22-19(23-4-2,14-21-12-11-20-15-21)18-10-9-16-7-5-6-8-17(16)13-18/h5-13,15H,3-4,14H2,1-2H3.
What are the key properties of 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole?
1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole has a molecular weight of 342.53 g/mol, XLogP of 5.40, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis(ethylsulfanyl)-2-naphthalen-2-ylethyl]imidazole is sourced from PubChem (CID 3054134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).