About 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione
5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 3054222) has the molecular formula C11H11N3O4
and a molecular weight of 249.23 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione |
| PubChem CID | 3054222 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C11H11N3O4/c1-11(2)9(15)13(10(16)12-11)7-3-5-8(6-4-7)14(17)18/h3-6H,1-2H3,(H,12,16) |
| InChIKey | IMXPYWYBIKKZRU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione (CID 3054222) is 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione is CC1(C)NC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O.
What is the InChIKey of 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione?
The InChIKey is IMXPYWYBIKKZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O4/c1-11(2)9(15)13(10(16)12-11)7-3-5-8(6-4-7)14(17)18/h3-6H,1-2H3,(H,12,16).
What are the key properties of 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione?
5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione has a molecular weight of 249.23 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-(4-nitrophenyl)imidazolidine-2,4-dione is sourced from PubChem (CID 3054222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).