C16H22N2O5 — CID 30542602
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]propanamide (PubChem CID 30542602) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 30542602 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[2-(2-methoxyethylamino)-2-oxoethyl]propanamide |
| SMILES | COCCNC(=O)CNC(=O)CCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H22N2O5/c1-21-7-6-17-16(20)11-18-15(19)5-3-12-2-4-13-14(10-12)23-9-8-22-13/h2,4,10H,3,5-9,11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | ZSCGDCFBASLREJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|