C21H23N5O2S — CID 3054269
2-[[N'-cyclohexyl-N-(2-methylquinolin-4-yl)carbamimidoyl]amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 3054269) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 2-[[N'-cyclohexyl-N-(2-methylquinolin-4-yl)carbamimidoyl]amino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[[N'-cyclohexyl-N-(2-methylquinolin-4-yl)carbamimidoyl]amino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 3054269 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[[N'-cyclohexyl-N-(2-methylquinolin-4-yl)carbamimidoyl]amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1cc(N/C(=N/C2CCCCC2)Nc2ncc(C(=O)O)s2)c2ccccc2n1 |
| InChI | InChI=1S/C21H23N5O2S/c1-13-11-17(15-9-5-6-10-16(15)23-13)25-20(24-14-7-3-2-4-8-14)26-21-22-12-18(29-21)19(27)28/h5-6,9-12,14H,2-4,7-8H2,1H3,(H,27,28)(H2,22,23,24,25,26) |
| InChIKey | IHRFVIBQQHXUFW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|