C18H22N6S — CID 3054275
2-tert-butyl-1-(2-methylquinolin-4-yl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)guanidine (PubChem CID 3054275) has the molecular formula C18H22N6S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-tert-butyl-1-(2-methylquinolin-4-yl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)guanidine.
| Compound Name | 2-tert-butyl-1-(2-methylquinolin-4-yl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 3054275 |
| Molecular Formula | C18H22N6S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-tert-butyl-1-(2-methylquinolin-4-yl)-3-(5-methyl-1,3,4-thiadiazol-2-yl)guanidine |
| SMILES | Cc1cc(N/C(=N/C(C)(C)C)Nc2nnc(C)s2)c2ccccc2n1 |
| InChI | InChI=1S/C18H22N6S/c1-11-10-15(13-8-6-7-9-14(13)19-11)20-16(22-18(3,4)5)21-17-24-23-12(2)25-17/h6-10H,1-5H3,(H2,19,20,21,22,24) |
| InChIKey | UGMBCCDANMKCFZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|