About 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid
4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid (PubChem CID 3054587) has the molecular formula C26H34N2O4
and a molecular weight of 438.57 g/mol. Its IUPAC name is 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid.
Molecular Properties
| Compound Name | 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid |
| PubChem CID | 3054587 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid |
| SMILES | CCc1cccc(C)c1N(CCCC(=O)O)C(=O)CCN(C(C)=O)c1c(C)cccc1C |
| InChI | InChI=1S/C26H34N2O4/c1-6-22-13-8-12-20(4)26(22)28(16-9-14-24(31)32)23(30)15-17-27(21(5)29)25-18(2)10-7-11-19(25)3/h7-8,10-13H,6,9,14-17H2,1-5H3,(H,31,32) |
| InChIKey | FMHLXXPSIAVFFN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid?
The IUPAC name of 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid (CID 3054587) is 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid.
What is the SMILES notation for 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid?
The canonical SMILES for 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid is CCc1cccc(C)c1N(CCCC(=O)O)C(=O)CCN(C(C)=O)c1c(C)cccc1C.
What is the InChIKey of 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid?
The InChIKey is FMHLXXPSIAVFFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N2O4/c1-6-22-13-8-12-20(4)26(22)28(16-9-14-24(31)32)23(30)15-17-27(21(5)29)25-18(2)10-7-11-19(25)3/h7-8,10-13H,6,9,14-17H2,1-5H3,(H,31,32).
What are the key properties of 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid?
4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid has a molecular weight of 438.57 g/mol, XLogP of 4.82, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[N-[3-(N-acetyl-2,6-dimethylanilino)propanoyl]-2-ethyl-6-methylanilino]butanoic acid is sourced from PubChem (CID 3054587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).