C19H24BrNS2 — CID 3054746
8-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,7,9,9a-octahydroquinolizin-5-ium bromide (PubChem CID 3054746) has the molecular formula C19H24BrNS2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 8-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,7,9,9a-octahydroquinolizin-5-ium bromide.
| Compound Name | 8-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,7,9,9a-octahydroquinolizin-5-ium bromide |
|---|---|
| PubChem CID | 3054746 |
| Molecular Formula | C19H24BrNS2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 8-(dithiophen-2-ylmethylidene)-5-methyl-1,2,3,4,6,7,9,9a-octahydroquinolizin-5-ium bromide |
| SMILES | C[N+]12CCCCC1CC(=C(c1cccs1)c1cccs1)CC2.[Br-] |
| InChI | InChI=1S/C19H24NS2.BrH/c1-20-10-3-2-6-16(20)14-15(9-11-20)19(17-7-4-12-21-17)18-8-5-13-22-18;/h4-5,7-8,12-13,16H,2-3,6,9-11,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | AMHXFTIPLJYQLQ-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|