About 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride
4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride (PubChem CID 3055010) has the molecular formula C22H25ClN2O3
and a molecular weight of 400.91 g/mol. Its IUPAC name is 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride |
| PubChem CID | 3055010 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride |
| SMILES | Cc1ccc(-c2oc(=O)oc2CCN2CCN(c3ccccc3)CC2)cc1.Cl |
| InChI | InChI=1S/C22H24N2O3.ClH/c1-17-7-9-18(10-8-17)21-20(26-22(25)27-21)11-12-23-13-15-24(16-14-23)19-5-3-2-4-6-19;/h2-10H,11-16H2,1H3;1H |
| InChIKey | ZTJIRKUXNCISJF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride?
The IUPAC name of 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride (CID 3055010) is 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride.
What is the SMILES notation for 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride?
The canonical SMILES for 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride is Cc1ccc(-c2oc(=O)oc2CCN2CCN(c3ccccc3)CC2)cc1.Cl.
What is the InChIKey of 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride?
The InChIKey is ZTJIRKUXNCISJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3.ClH/c1-17-7-9-18(10-8-17)21-20(26-22(25)27-21)11-12-23-13-15-24(16-14-23)19-5-3-2-4-6-19;/h2-10H,11-16H2,1H3;1H.
What are the key properties of 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride?
4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride has a molecular weight of 400.91 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-5-[2-(4-phenylpiperazin-1-yl)ethyl]-1,3-dioxol-2-one;hydrochloride is sourced from PubChem (CID 3055010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).