C15H26N2O4 — CID 3055078
2-(dimethylamino)ethyl 8-ethyl-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate (PubChem CID 3055078) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 8-ethyl-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 8-ethyl-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 3055078 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-(dimethylamino)ethyl 8-ethyl-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate |
| SMILES | CCC1CCC2(CC1)CN(C(=O)OCCN(C)C)C(=O)O2 |
| InChI | InChI=1S/C15H26N2O4/c1-4-12-5-7-15(8-6-12)11-17(14(19)21-15)13(18)20-10-9-16(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | RHKDRWNCJMHLQG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |