C9H3Cl2F7 — CID 3055113
2-chloro-1-(2-chloro-1,1,2,2-tetrafluoroethyl)-4-(trifluoromethyl)benzene (PubChem CID 3055113) has the molecular formula C9H3Cl2F7 and a molecular weight of 315.02 g/mol. Its IUPAC name is 2-chloro-1-(2-chloro-1,1,2,2-tetrafluoroethyl)-4-(trifluoromethyl)benzene.
| Compound Name | 2-chloro-1-(2-chloro-1,1,2,2-tetrafluoroethyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 3055113 |
| Molecular Formula | C9H3Cl2F7 |
| Molecular Weight | 315.02 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 2-chloro-1-(2-chloro-1,1,2,2-tetrafluoroethyl)-4-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccc(C(F)(F)C(F)(F)Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H3Cl2F7/c10-6-3-4(8(14,15)16)1-2-5(6)7(12,13)9(11,17)18/h1-3H |
| InChIKey | RPLAIIXJNIVGAE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.02 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|