C24H20N4O2S — CID 3055152
N-[(4-methylphenyl)carbamothioyl]-2-(4-oxo-2-phenylquinazolin-3-yl)acetamide (PubChem CID 3055152) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-[(4-methylphenyl)carbamothioyl]-2-(4-oxo-2-phenylquinazolin-3-yl)acetamide.
| Compound Name | N-[(4-methylphenyl)carbamothioyl]-2-(4-oxo-2-phenylquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 3055152 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[(4-methylphenyl)carbamothioyl]-2-(4-oxo-2-phenylquinazolin-3-yl)acetamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)Cn2c(-c3ccccc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H20N4O2S/c1-16-11-13-18(14-12-16)25-24(31)27-21(29)15-28-22(17-7-3-2-4-8-17)26-20-10-6-5-9-19(20)23(28)30/h2-14H,15H2,1H3,(H2,25,27,29,31) |
| InChIKey | LNQRXKXXZSLJLL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|