About 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate
2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate (PubChem CID 3055230) has the molecular formula C19H20ClNO3
and a molecular weight of 345.83 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate |
| PubChem CID | 3055230 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)CCC2)c1ccc(OCCCCCl)cn1 |
| InChI | InChI=1S/C19H20ClNO3/c20-10-1-2-11-23-17-8-9-18(21-13-17)19(22)24-16-7-6-14-4-3-5-15(14)12-16/h6-9,12-13H,1-5,10-11H2 |
| InChIKey | SOHXCFMYNTWRCV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate?
The IUPAC name of 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate (CID 3055230) is 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate.
What is the SMILES notation for 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate?
The canonical SMILES for 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate is O=C(Oc1ccc2c(c1)CCC2)c1ccc(OCCCCCl)cn1.
What is the InChIKey of 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate?
The InChIKey is SOHXCFMYNTWRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClNO3/c20-10-1-2-11-23-17-8-9-18(21-13-17)19(22)24-16-7-6-14-4-3-5-15(14)12-16/h6-9,12-13H,1-5,10-11H2.
What are the key properties of 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate?
2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate has a molecular weight of 345.83 g/mol, XLogP of 4.19, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-5-yl 5-(4-chlorobutoxy)pyridine-2-carboxylate is sourced from PubChem (CID 3055230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).