About 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate
2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate (PubChem CID 3055236) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate |
| PubChem CID | 3055236 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc3c(c2)CCC3)nc1 |
| InChI | InChI=1S/C19H21NO3/c1-2-3-11-22-17-9-10-18(20-13-17)19(21)23-16-8-7-14-5-4-6-15(14)12-16/h7-10,12-13H,2-6,11H2,1H3 |
| InChIKey | LIFCWPVHMDYZHU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate?
The IUPAC name of 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate (CID 3055236) is 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate.
What is the SMILES notation for 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate?
The canonical SMILES for 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate is CCCCOc1ccc(C(=O)Oc2ccc3c(c2)CCC3)nc1.
What is the InChIKey of 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate?
The InChIKey is LIFCWPVHMDYZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-2-3-11-22-17-9-10-18(20-13-17)19(21)23-16-8-7-14-5-4-6-15(14)12-16/h7-10,12-13H,2-6,11H2,1H3.
What are the key properties of 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate?
2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate has a molecular weight of 311.38 g/mol, XLogP of 3.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-5-yl 5-butoxypyridine-2-carboxylate is sourced from PubChem (CID 3055236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).