About butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole
butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (PubChem CID 3055248) has the molecular formula C19H24N2O5
and a molecular weight of 360.41 g/mol. Its IUPAC name is butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
Molecular Properties
| Compound Name | butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| PubChem CID | 3055248 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole |
| SMILES | COc1ccc2[nH]cc(C3=CCN(C)CC3)c2c1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C15H18N2O.C4H6O4/c1-17-7-5-11(6-8-17)14-10-16-15-4-3-12(18-2)9-13(14)15;5-3(6)1-2-4(7)8/h3-5,9-10,16H,6-8H2,1-2H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | BPYPQRDXENNRHJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
The IUPAC name of butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole (CID 3055248) is butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole.
What is the SMILES notation for butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
The canonical SMILES for butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole is COc1ccc2[nH]cc(C3=CCN(C)CC3)c2c1.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
The InChIKey is BPYPQRDXENNRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.C4H6O4/c1-17-7-5-11(6-8-17)14-10-16-15-4-3-12(18-2)9-13(14)15;5-3(6)1-2-4(7)8/h3-5,9-10,16H,6-8H2,1-2H3;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole?
butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole has a molecular weight of 360.41 g/mol, XLogP of 2.83, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;5-methoxy-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole is sourced from PubChem (CID 3055248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).