C20H27Cl2NO — CID 3055346
4-[2-[2-(2-chlorophenyl)ethyl]phenoxy]-N,N-dimethylbutan-1-amine;hydrochloride (PubChem CID 3055346) has the molecular formula C20H27Cl2NO and a molecular weight of 368.35 g/mol. Its IUPAC name is 4-[2-[2-(2-chlorophenyl)ethyl]phenoxy]-N,N-dimethylbutan-1-amine;hydrochloride.
| Compound Name | 4-[2-[2-(2-chlorophenyl)ethyl]phenoxy]-N,N-dimethylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3055346 |
| Molecular Formula | C20H27Cl2NO |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[2-[2-(2-chlorophenyl)ethyl]phenoxy]-N,N-dimethylbutan-1-amine;hydrochloride |
| SMILES | CN(C)CCCCOc1ccccc1CCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C20H26ClNO.ClH/c1-22(2)15-7-8-16-23-20-12-6-4-10-18(20)14-13-17-9-3-5-11-19(17)21;/h3-6,9-12H,7-8,13-16H2,1-2H3;1H |
| InChIKey | ICLMRNKXRZJGAR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|