C21H27ClN2O — CID 3055378
2-(diethylamino)-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetamide;hydrochloride (PubChem CID 3055378) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetamide;hydrochloride.
| Compound Name | 2-(diethylamino)-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 3055378 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-(diethylamino)-N-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)acetamide;hydrochloride |
| SMILES | CCN(CC)CC(=O)NC1c2ccccc2CCc2ccccc21.Cl |
| InChI | InChI=1S/C21H26N2O.ClH/c1-3-23(4-2)15-20(24)22-21-18-11-7-5-9-16(18)13-14-17-10-6-8-12-19(17)21;/h5-12,21H,3-4,13-15H2,1-2H3,(H,22,24);1H |
| InChIKey | NOLDNHXTMXLJSY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |