About N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride
N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride (PubChem CID 3055387) has the molecular formula C17H27ClN2O
and a molecular weight of 310.87 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride |
| PubChem CID | 3055387 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride |
| SMILES | CCCN(CCC)CC(=O)NC1CCc2ccccc21.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-3-11-19(12-4-2)13-17(20)18-16-10-9-14-7-5-6-8-15(14)16;/h5-8,16H,3-4,9-13H2,1-2H3,(H,18,20);1H |
| InChIKey | RBKAHBDUBCYBRG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride?
The IUPAC name of N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride (CID 3055387) is N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride?
The canonical SMILES for N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride is CCCN(CCC)CC(=O)NC1CCc2ccccc21.Cl.
What is the InChIKey of N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride?
The InChIKey is RBKAHBDUBCYBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O.ClH/c1-3-11-19(12-4-2)13-17(20)18-16-10-9-14-7-5-6-8-15(14)16;/h5-8,16H,3-4,9-13H2,1-2H3,(H,18,20);1H.
What are the key properties of N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride?
N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride has a molecular weight of 310.87 g/mol, XLogP of 3.33, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-1-yl)-2-(dipropylamino)acetamide;hydrochloride is sourced from PubChem (CID 3055387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).