About ethyl 4-imidazol-1-ylbutanoate
ethyl 4-imidazol-1-ylbutanoate (PubChem CID 3055389) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is ethyl 4-imidazol-1-ylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-imidazol-1-ylbutanoate |
| PubChem CID | 3055389 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | ethyl 4-imidazol-1-ylbutanoate |
| SMILES | CCOC(=O)CCCn1ccnc1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-13-9(12)4-3-6-11-7-5-10-8-11/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | RDNHWIOBCYOAMM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-imidazol-1-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-imidazol-1-ylbutanoate?
The IUPAC name of ethyl 4-imidazol-1-ylbutanoate (CID 3055389) is ethyl 4-imidazol-1-ylbutanoate.
What is the SMILES notation for ethyl 4-imidazol-1-ylbutanoate?
The canonical SMILES for ethyl 4-imidazol-1-ylbutanoate is CCOC(=O)CCCn1ccnc1.
What is the InChIKey of ethyl 4-imidazol-1-ylbutanoate?
The InChIKey is RDNHWIOBCYOAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-13-9(12)4-3-6-11-7-5-10-8-11/h5,7-8H,2-4,6H2,1H3.
What are the key properties of ethyl 4-imidazol-1-ylbutanoate?
ethyl 4-imidazol-1-ylbutanoate has a molecular weight of 182.22 g/mol, XLogP of 1.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-imidazol-1-ylbutanoate is sourced from PubChem (CID 3055389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).