C19H28O3 — CID 3055498
2-(3-hydroxy-3,7-dimethyloct-6-enyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 3055498) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(3-hydroxy-3,7-dimethyloct-6-enyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3-hydroxy-3,7-dimethyloct-6-enyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 3055498 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-(3-hydroxy-3,7-dimethyloct-6-enyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)=CCCC(C)(O)CCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C19H28O3/c1-12(2)8-7-10-19(6,22)11-9-16-15(5)17(20)13(3)14(4)18(16)21/h8,22H,7,9-11H2,1-6H3 |
| InChIKey | XBCVZPHYCOXGAQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|