C13H17ClN2S — CID 3055522
4,4,6-trimethyl-N-phenyl-1,3-thiazin-2-amine;hydrochloride (PubChem CID 3055522) has the molecular formula C13H17ClN2S and a molecular weight of 268.81 g/mol. Its IUPAC name is 4,4,6-trimethyl-N-phenyl-1,3-thiazin-2-amine;hydrochloride.
| Compound Name | 4,4,6-trimethyl-N-phenyl-1,3-thiazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 3055522 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4,4,6-trimethyl-N-phenyl-1,3-thiazin-2-amine;hydrochloride |
| SMILES | CC1=CC(C)(C)N=C(Nc2ccccc2)S1.Cl |
| InChI | InChI=1S/C13H16N2S.ClH/c1-10-9-13(2,3)15-12(16-10)14-11-7-5-4-6-8-11;/h4-9H,1-3H3,(H,14,15);1H |
| InChIKey | LQZRCRSIPSWWKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |