C12H12N2O — CID 3055560
2-(1-benzofuran-2-yl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 3055560) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(1-benzofuran-2-yl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 3055560 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | c1ccc2oc(C3=NCCCN3)cc2c1 |
| InChI | InChI=1S/C12H12N2O/c1-2-5-10-9(4-1)8-11(15-10)12-13-6-3-7-14-12/h1-2,4-5,8H,3,6-7H2,(H,13,14) |
| InChIKey | MYEVXBIYMPENHA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |