C17H10N4O5 — CID 30556121
4-nitro-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]isoindole-1,3-dione (PubChem CID 30556121) has the molecular formula C17H10N4O5 and a molecular weight of 350.29 g/mol. Its IUPAC name is 4-nitro-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-nitro-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 30556121 |
| Molecular Formula | C17H10N4O5 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 4-nitro-2-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C17H10N4O5/c22-16-11-7-4-8-12(21(24)25)14(11)17(23)20(16)9-13-18-15(19-26-13)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | RBABHQFKRPZFSX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|