C24H30NO4PS — CID 3055781
(2S,3R,4S,6R)-4-(2-diethoxyphosphorylsulfanylethynyl)-3-methyl-2,6-diphenylpiperidin-4-ol (PubChem CID 3055781) has the molecular formula C24H30NO4PS and a molecular weight of 459.55 g/mol. Its IUPAC name is (2S,3R,4S,6R)-4-(2-diethoxyphosphorylsulfanylethynyl)-3-methyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | (2S,3R,4S,6R)-4-(2-diethoxyphosphorylsulfanylethynyl)-3-methyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 3055781 |
| Molecular Formula | C24H30NO4PS |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (2S,3R,4S,6R)-4-(2-diethoxyphosphorylsulfanylethynyl)-3-methyl-2,6-diphenylpiperidin-4-ol |
| SMILES | CCOP(=O)(OCC)SC#C[C@]1(O)C[C@H](c2ccccc2)N[C@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C24H30NO4PS/c1-4-28-30(27,29-5-2)31-17-16-24(26)18-22(20-12-8-6-9-13-20)25-23(19(24)3)21-14-10-7-11-15-21/h6-15,19,22-23,25-26H,4-5,18H2,1-3H3/t19-,22-,23+,24+/m1/s1 |
| InChIKey | PEEFZAKQOLHLMZ-JFTIXFDTSA-N |
| XLogP | 5.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|