About 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine
1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine (PubChem CID 3055979) has the molecular formula C18H19ClN2S
and a molecular weight of 330.88 g/mol. Its IUPAC name is 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine.
Molecular Properties
| Compound Name | 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine |
| PubChem CID | 3055979 |
| Molecular Formula | C18H19ClN2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine |
| SMILES | Clc1ccc2c(c1)CC(N1CCNCC1)c1ccccc1S2 |
| InChI | InChI=1S/C18H19ClN2S/c19-14-5-6-17-13(11-14)12-16(21-9-7-20-8-10-21)15-3-1-2-4-18(15)22-17/h1-6,11,16,20H,7-10,12H2 |
| InChIKey | ZYUDAIAKGACNCP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine?
The IUPAC name of 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine (CID 3055979) is 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine.
What is the SMILES notation for 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine?
The canonical SMILES for 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine is Clc1ccc2c(c1)CC(N1CCNCC1)c1ccccc1S2.
What is the InChIKey of 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine?
The InChIKey is ZYUDAIAKGACNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2S/c19-14-5-6-17-13(11-14)12-16(21-9-7-20-8-10-21)15-3-1-2-4-18(15)22-17/h1-6,11,16,20H,7-10,12H2.
What are the key properties of 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine?
1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine has a molecular weight of 330.88 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)piperazine is sourced from PubChem (CID 3055979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).