C26H34N6O2S — CID 30560333
2-[[4-benzyl-5-[(1S)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 30560333) has the molecular formula C26H34N6O2S and a molecular weight of 494.67 g/mol. Its IUPAC name is 2-[[4-benzyl-5-[(1S)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[4-benzyl-5-[(1S)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 30560333 |
| Molecular Formula | C26H34N6O2S |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[[4-benzyl-5-[(1S)-1-(dimethylamino)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CC[C@@H](c1nnc(SCC(=O)Nc2ccc(N3CCOCC3)cc2)n1Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C26H34N6O2S/c1-4-23(30(2)3)25-28-29-26(32(25)18-20-8-6-5-7-9-20)35-19-24(33)27-21-10-12-22(13-11-21)31-14-16-34-17-15-31/h5-13,23H,4,14-19H2,1-3H3,(H,27,33)/t23-/m0/s1 |
| InChIKey | XTGVCAKKNHEFPN-QHCPKHFHSA-N |
| XLogP | 3.91 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|