C12H19NO — CID 3056050
N-[(1R,2R,6R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide (PubChem CID 3056050) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[(1R,2R,6R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide.
| Compound Name | N-[(1R,2R,6R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
|---|---|
| PubChem CID | 3056050 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-[(1R,2R,6R,7R,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@H]2C[C@@H]1[C@@H]1CCC[C@H]21 |
| InChI | InChI=1S/C12H19NO/c1-7(14)13-12-6-8-5-11(12)10-4-2-3-9(8)10/h8-12H,2-6H2,1H3,(H,13,14)/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | JBSRXWWWDDOZPL-LZQZFOIKSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |