About (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone
(4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone (PubChem CID 3056056) has the molecular formula C25H22O3
and a molecular weight of 370.45 g/mol. Its IUPAC name is (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone |
| PubChem CID | 3056056 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone |
| SMILES | COc1ccc(C(=O)c2ccc3cc(-c4c(C)cc(C)cc4C)oc3c2)cc1 |
| InChI | InChI=1S/C25H22O3/c1-15-11-16(2)24(17(3)12-15)23-13-19-5-6-20(14-22(19)28-23)25(26)18-7-9-21(27-4)10-8-18/h5-14H,1-4H3 |
| InChIKey | YPRCKYBLWFWPQP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone?
The IUPAC name of (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone (CID 3056056) is (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone.
What is the SMILES notation for (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone?
The canonical SMILES for (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone is COc1ccc(C(=O)c2ccc3cc(-c4c(C)cc(C)cc4C)oc3c2)cc1.
What is the InChIKey of (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone?
The InChIKey is YPRCKYBLWFWPQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O3/c1-15-11-16(2)24(17(3)12-15)23-13-19-5-6-20(14-22(19)28-23)25(26)18-7-9-21(27-4)10-8-18/h5-14H,1-4H3.
What are the key properties of (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone?
(4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone has a molecular weight of 370.45 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-[2-(2,4,6-trimethylphenyl)-1-benzofuran-6-yl]methanone is sourced from PubChem (CID 3056056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).