About 7-phenylpteridin-4-amine
7-phenylpteridin-4-amine (PubChem CID 3056066) has the molecular formula C12H9N5
and a molecular weight of 223.24 g/mol. Its IUPAC name is 7-phenylpteridin-4-amine.
Molecular Properties
| Compound Name | 7-phenylpteridin-4-amine |
| PubChem CID | 3056066 |
| Molecular Formula | C12H9N5 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 7-phenylpteridin-4-amine |
| SMILES | Nc1ncnc2nc(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C12H9N5/c13-11-10-12(16-7-15-11)17-9(6-14-10)8-4-2-1-3-5-8/h1-7H,(H2,13,15,16,17) |
| InChIKey | YZCLSEIRDPNKJP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-phenylpteridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylpteridin-4-amine?
The IUPAC name of 7-phenylpteridin-4-amine (CID 3056066) is 7-phenylpteridin-4-amine.
What is the SMILES notation for 7-phenylpteridin-4-amine?
The canonical SMILES for 7-phenylpteridin-4-amine is Nc1ncnc2nc(-c3ccccc3)cnc12.
What is the InChIKey of 7-phenylpteridin-4-amine?
The InChIKey is YZCLSEIRDPNKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N5/c13-11-10-12(16-7-15-11)17-9(6-14-10)8-4-2-1-3-5-8/h1-7H,(H2,13,15,16,17).
What are the key properties of 7-phenylpteridin-4-amine?
7-phenylpteridin-4-amine has a molecular weight of 223.24 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylpteridin-4-amine is sourced from PubChem (CID 3056066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).