About 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride
4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride (PubChem CID 3056078) has the molecular formula C12H19ClN2O
and a molecular weight of 242.75 g/mol. Its IUPAC name is 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 3056078 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride |
| SMILES | CCCN/C(=N\C)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-4-9-14-12(13-2)10-5-7-11(15-3)8-6-10;/h5-8H,4,9H2,1-3H3,(H,13,14);1H |
| InChIKey | UMINTTZEYOVSQN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride?
The IUPAC name of 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride (CID 3056078) is 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride is CCCN/C(=N\C)c1ccc(OC)cc1.Cl.
What is the InChIKey of 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride?
The InChIKey is UMINTTZEYOVSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O.ClH/c1-4-9-14-12(13-2)10-5-7-11(15-3)8-6-10;/h5-8H,4,9H2,1-3H3,(H,13,14);1H.
What are the key properties of 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride?
4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride has a molecular weight of 242.75 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N'-methyl-N-propylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 3056078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).