About 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride
4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride (PubChem CID 3056209) has the molecular formula C15H21Cl2N3S
and a molecular weight of 346.33 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride |
| PubChem CID | 3056209 |
| Molecular Formula | C15H21Cl2N3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride |
| SMILES | Cc1ccc(Cc2csc(N3CCNCC3)n2)cc1.Cl.Cl |
| InChI | InChI=1S/C15H19N3S.2ClH/c1-12-2-4-13(5-3-12)10-14-11-19-15(17-14)18-8-6-16-7-9-18;;/h2-5,11,16H,6-10H2,1H3;2*1H |
| InChIKey | JBAPXIWXXSLOAA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride?
The IUPAC name of 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride (CID 3056209) is 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride?
The canonical SMILES for 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride is Cc1ccc(Cc2csc(N3CCNCC3)n2)cc1.Cl.Cl.
What is the InChIKey of 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride?
The InChIKey is JBAPXIWXXSLOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3S.2ClH/c1-12-2-4-13(5-3-12)10-14-11-19-15(17-14)18-8-6-16-7-9-18;;/h2-5,11,16H,6-10H2,1H3;2*1H.
What are the key properties of 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride?
4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride has a molecular weight of 346.33 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methylphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 3056209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).