About 2-amino-4,5-dimethylbenzenethiol;hydrochloride
2-amino-4,5-dimethylbenzenethiol;hydrochloride (PubChem CID 3056307) has the molecular formula C8H12ClNS
and a molecular weight of 189.71 g/mol. Its IUPAC name is 2-amino-4,5-dimethylbenzenethiol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethylbenzenethiol;hydrochloride |
| PubChem CID | 3056307 |
| Molecular Formula | C8H12ClNS |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2-amino-4,5-dimethylbenzenethiol;hydrochloride |
| SMILES | Cc1cc(N)c(S)cc1C.Cl |
| InChI | InChI=1S/C8H11NS.ClH/c1-5-3-7(9)8(10)4-6(5)2;/h3-4,10H,9H2,1-2H3;1H |
| InChIKey | IMZGYPGQERGYQT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethylbenzenethiol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethylbenzenethiol;hydrochloride?
The IUPAC name of 2-amino-4,5-dimethylbenzenethiol;hydrochloride (CID 3056307) is 2-amino-4,5-dimethylbenzenethiol;hydrochloride.
What is the SMILES notation for 2-amino-4,5-dimethylbenzenethiol;hydrochloride?
The canonical SMILES for 2-amino-4,5-dimethylbenzenethiol;hydrochloride is Cc1cc(N)c(S)cc1C.Cl.
What is the InChIKey of 2-amino-4,5-dimethylbenzenethiol;hydrochloride?
The InChIKey is IMZGYPGQERGYQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS.ClH/c1-5-3-7(9)8(10)4-6(5)2;/h3-4,10H,9H2,1-2H3;1H.
What are the key properties of 2-amino-4,5-dimethylbenzenethiol;hydrochloride?
2-amino-4,5-dimethylbenzenethiol;hydrochloride has a molecular weight of 189.71 g/mol, XLogP of 2.60, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethylbenzenethiol;hydrochloride is sourced from PubChem (CID 3056307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).