About 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol
3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol (PubChem CID 3056354) has the molecular formula C22H35NO2
and a molecular weight of 345.53 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol.
Molecular Properties
| Compound Name | 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol |
| PubChem CID | 3056354 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol |
| SMILES | CCCCCN1CCC2(CC1)c1cc(O)ccc1C(C)(C)OC2CC |
| InChI | InChI=1S/C22H35NO2/c1-5-7-8-13-23-14-11-22(12-15-23)19-16-17(24)9-10-18(19)21(3,4)25-20(22)6-2/h9-10,16,20,24H,5-8,11-15H2,1-4H3 |
| InChIKey | WCCBATQOQNFYQV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol?
The IUPAC name of 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol (CID 3056354) is 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol.
What is the SMILES notation for 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol?
The canonical SMILES for 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol is CCCCCN1CCC2(CC1)c1cc(O)ccc1C(C)(C)OC2CC.
What is the InChIKey of 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol?
The InChIKey is WCCBATQOQNFYQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO2/c1-5-7-8-13-23-14-11-22(12-15-23)19-16-17(24)9-10-18(19)21(3,4)25-20(22)6-2/h9-10,16,20,24H,5-8,11-15H2,1-4H3.
What are the key properties of 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol?
3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol has a molecular weight of 345.53 g/mol, XLogP of 4.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,1-dimethyl-1'-pentylspiro[3H-isochromene-4,4'-piperidine]-6-ol is sourced from PubChem (CID 3056354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).